C18H13N3O — CID 11150373
5,7-diphenyl-1,3-dihydroimidazo[4,5-b]pyridin-2-one (PubChem CID 11150373) has the molecular formula C18H13N3O and a molecular weight of 287.32 g/mol. Its IUPAC name is 5,7-diphenyl-1,3-dihydroimidazo[4,5-b]pyridin-2-one.
| Compound Name | 5,7-diphenyl-1,3-dihydroimidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 11150373 |
| Molecular Formula | C18H13N3O |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 5,7-diphenyl-1,3-dihydroimidazo[4,5-b]pyridin-2-one |
| SMILES | O=c1[nH]c2nc(-c3ccccc3)cc(-c3ccccc3)c2[nH]1 |
| InChI | InChI=1S/C18H13N3O/c22-18-20-16-14(12-7-3-1-4-8-12)11-15(19-17(16)21-18)13-9-5-2-6-10-13/h1-11H,(H2,19,20,21,22) |
| InChIKey | SHTZPAWLYJASHR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |