C16H30N2O2 — CID 111505319
1-[(3-hydroxycyclohexyl)methyl]-3-[(2-methylcyclohexyl)methyl]urea (PubChem CID 111505319) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 1-[(3-hydroxycyclohexyl)methyl]-3-[(2-methylcyclohexyl)methyl]urea.
| Compound Name | 1-[(3-hydroxycyclohexyl)methyl]-3-[(2-methylcyclohexyl)methyl]urea |
|---|---|
| PubChem CID | 111505319 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 1-[(3-hydroxycyclohexyl)methyl]-3-[(2-methylcyclohexyl)methyl]urea |
| SMILES | CC1CCCCC1CNC(=O)NCC1CCCC(O)C1 |
| InChI | InChI=1S/C16H30N2O2/c1-12-5-2-3-7-14(12)11-18-16(20)17-10-13-6-4-8-15(19)9-13/h12-15,19H,2-11H2,1H3,(H2,17,18,20) |
| InChIKey | VKQUNHKMFQGKQE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |