C14H23N3O2S — CID 11150658
1-(3-morpholin-4-ylpropyl)-3-prop-2-enyl-2-sulfanylidene-1,3-diazinan-4-one (PubChem CID 11150658) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is 1-(3-morpholin-4-ylpropyl)-3-prop-2-enyl-2-sulfanylidene-1,3-diazinan-4-one.
| Compound Name | 1-(3-morpholin-4-ylpropyl)-3-prop-2-enyl-2-sulfanylidene-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 11150658 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 1-(3-morpholin-4-ylpropyl)-3-prop-2-enyl-2-sulfanylidene-1,3-diazinan-4-one |
| SMILES | C=CCN1C(=O)CCN(CCCN2CCOCC2)C1=S |
| InChI | InChI=1S/C14H23N3O2S/c1-2-5-17-13(18)4-8-16(14(17)20)7-3-6-15-9-11-19-12-10-15/h2H,1,3-12H2 |
| InChIKey | BFPCWQKWOYCFFE-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|