C11H12BrN3O2 — CID 11150668
1-[(3-bromo-4,5-dihydro-1,2-oxazol-5-yl)methyl]-3-phenylurea (PubChem CID 11150668) has the molecular formula C11H12BrN3O2 and a molecular weight of 298.14 g/mol. Its IUPAC name is 1-[(3-bromo-4,5-dihydro-1,2-oxazol-5-yl)methyl]-3-phenylurea.
| Compound Name | 1-[(3-bromo-4,5-dihydro-1,2-oxazol-5-yl)methyl]-3-phenylurea |
|---|---|
| PubChem CID | 11150668 |
| Molecular Formula | C11H12BrN3O2 |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 1-[(3-bromo-4,5-dihydro-1,2-oxazol-5-yl)methyl]-3-phenylurea |
| SMILES | O=C(NCC1CC(Br)=NO1)Nc1ccccc1 |
| InChI | InChI=1S/C11H12BrN3O2/c12-10-6-9(17-15-10)7-13-11(16)14-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H2,13,14,16) |
| InChIKey | AOWQWUZNCRUJAX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |