C16H32O3Si — CID 11150758
[(Z,7R)-7-[tert-butyl(dimethyl)silyl]oxyoct-5-enyl] acetate (PubChem CID 11150758) has the molecular formula C16H32O3Si and a molecular weight of 300.52 g/mol. Its IUPAC name is [(Z,7R)-7-[tert-butyl(dimethyl)silyl]oxyoct-5-enyl] acetate.
| Compound Name | [(Z,7R)-7-[tert-butyl(dimethyl)silyl]oxyoct-5-enyl] acetate |
|---|---|
| PubChem CID | 11150758 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.52 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | [(Z,7R)-7-[tert-butyl(dimethyl)silyl]oxyoct-5-enyl] acetate |
| SMILES | CC(=O)OCCCC/C=C\[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O3Si/c1-14(19-20(6,7)16(3,4)5)12-10-8-9-11-13-18-15(2)17/h10,12,14H,8-9,11,13H2,1-7H3/b12-10-/t14-/m1/s1 |
| InChIKey | QTRZWKVNUJIZEU-GAJOTYCWSA-N |
| XLogP | 4.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|