C17H29N3O2S — CID 111508204
1-[2-(1-ethylpiperidin-4-yl)ethyl]-3-(2-hydroxy-2-thiophen-3-ylpropyl)urea (PubChem CID 111508204) has the molecular formula C17H29N3O2S and a molecular weight of 339.51 g/mol. Its IUPAC name is 1-[2-(1-ethylpiperidin-4-yl)ethyl]-3-(2-hydroxy-2-thiophen-3-ylpropyl)urea.
| Compound Name | 1-[2-(1-ethylpiperidin-4-yl)ethyl]-3-(2-hydroxy-2-thiophen-3-ylpropyl)urea |
|---|---|
| PubChem CID | 111508204 |
| Molecular Formula | C17H29N3O2S |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 1-[2-(1-ethylpiperidin-4-yl)ethyl]-3-(2-hydroxy-2-thiophen-3-ylpropyl)urea |
| SMILES | CCN1CCC(CCNC(=O)NCC(C)(O)c2ccsc2)CC1 |
| InChI | InChI=1S/C17H29N3O2S/c1-3-20-9-5-14(6-10-20)4-8-18-16(21)19-13-17(2,22)15-7-11-23-12-15/h7,11-12,14,22H,3-6,8-10,13H2,1-2H3,(H2,18,19,21) |
| InChIKey | VJDOTZZRTILEGO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |