C16H24N2O3S — CID 96567072
(2R)-1-butanoyl-N-[(2S)-2-hydroxy-2-thiophen-3-ylpropyl]pyrrolidine-2-carboxamide (PubChem CID 96567072) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is (2R)-1-butanoyl-N-[(2S)-2-hydroxy-2-thiophen-3-ylpropyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-butanoyl-N-[(2S)-2-hydroxy-2-thiophen-3-ylpropyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 96567072 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (2R)-1-butanoyl-N-[(2S)-2-hydroxy-2-thiophen-3-ylpropyl]pyrrolidine-2-carboxamide |
| SMILES | CCCC(=O)N1CCC[C@@H]1C(=O)NC[C@@](C)(O)c1ccsc1 |
| InChI | InChI=1S/C16H24N2O3S/c1-3-5-14(19)18-8-4-6-13(18)15(20)17-11-16(2,21)12-7-9-22-10-12/h7,9-10,13,21H,3-6,8,11H2,1-2H3,(H,17,20)/t13-,16-/m1/s1 |
| InChIKey | ZRLCCIQOMVDBJO-CZUORRHYSA-N |
| XLogP | 1.86 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |