C18H28IN9 — CID 111510146
1-butyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111510146) has the molecular formula C18H28IN9 and a molecular weight of 497.39 g/mol. Its IUPAC name is 1-butyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-butyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111510146 |
| Molecular Formula | C18H28IN9 |
| Molecular Weight | 497.39 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | 1-butyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCCCN/C(=N\Cc1nnc2ccccn12)NCCn1cnnc1CC.I |
| InChI | InChI=1S/C18H27N9.HI/c1-3-5-9-19-18(20-10-12-26-14-22-23-15(26)4-2)21-13-17-25-24-16-8-6-7-11-27(16)17;/h6-8,11,14H,3-5,9-10,12-13H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | SLCKMXBSIBQLAY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 97.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|