C15H25F3OS — CID 11151055
3-[(Z)-dodec-9-enyl]sulfanyl-1,1,1-trifluoropropan-2-one (PubChem CID 11151055) has the molecular formula C15H25F3OS and a molecular weight of 310.43 g/mol. Its IUPAC name is 3-[(Z)-dodec-9-enyl]sulfanyl-1,1,1-trifluoropropan-2-one.
| Compound Name | 3-[(Z)-dodec-9-enyl]sulfanyl-1,1,1-trifluoropropan-2-one |
|---|---|
| PubChem CID | 11151055 |
| Molecular Formula | C15H25F3OS |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 3-[(Z)-dodec-9-enyl]sulfanyl-1,1,1-trifluoropropan-2-one |
| SMILES | CC/C=C\CCCCCCCCSCC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H25F3OS/c1-2-3-4-5-6-7-8-9-10-11-12-20-13-14(19)15(16,17)18/h3-4H,2,5-13H2,1H3/b4-3- |
| InChIKey | BYXSUEPOHYSWOZ-ARJAWSKDSA-N |
| XLogP | 5.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|