C13H11ClN2OS2 — CID 11151064
N-(4-chlorophenyl)-2-[(5-methylthiophen-2-yl)amino]-2-sulfanylideneacetamide (PubChem CID 11151064) has the molecular formula C13H11ClN2OS2 and a molecular weight of 310.83 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(5-methylthiophen-2-yl)amino]-2-sulfanylideneacetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(5-methylthiophen-2-yl)amino]-2-sulfanylideneacetamide |
|---|---|
| PubChem CID | 11151064 |
| Molecular Formula | C13H11ClN2OS2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(5-methylthiophen-2-yl)amino]-2-sulfanylideneacetamide |
| SMILES | Cc1ccc(NC(=S)C(=O)Nc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C13H11ClN2OS2/c1-8-2-7-11(19-8)16-13(18)12(17)15-10-5-3-9(14)4-6-10/h2-7H,1H3,(H,15,17)(H,16,18) |
| InChIKey | URLSERCSTSBTLD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|