C19H28N6S — CID 111512370
N-ethyl-N'-(2-methyl-3-thiophen-2-ylpropyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 111512370) has the molecular formula C19H28N6S and a molecular weight of 372.54 g/mol. Its IUPAC name is N-ethyl-N'-(2-methyl-3-thiophen-2-ylpropyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-(2-methyl-3-thiophen-2-ylpropyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111512370 |
| Molecular Formula | C19H28N6S |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | N-ethyl-N'-(2-methyl-3-thiophen-2-ylpropyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C)Cc1cccs1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H28N6S/c1-3-20-18(23-15-16(2)14-17-6-4-13-26-17)24-9-11-25(12-10-24)19-21-7-5-8-22-19/h4-8,13,16H,3,9-12,14-15H2,1-2H3,(H,20,23) |
| InChIKey | RXWHCDUMGSVQGV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|