C18H29O3P — CID 11151486
(6E)-6-butyl-7-diethoxyphosphoryldeca-1,2,6-trien-9-yne (PubChem CID 11151486) has the molecular formula C18H29O3P and a molecular weight of 324.40 g/mol. Its IUPAC name is (6E)-6-butyl-7-diethoxyphosphoryldeca-1,2,6-trien-9-yne.
| Compound Name | (6E)-6-butyl-7-diethoxyphosphoryldeca-1,2,6-trien-9-yne |
|---|---|
| PubChem CID | 11151486 |
| Molecular Formula | C18H29O3P |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (6E)-6-butyl-7-diethoxyphosphoryldeca-1,2,6-trien-9-yne |
| SMILES | C#CC/C(=C(\CCC=C=C)CCCC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C18H29O3P/c1-6-11-13-16-17(15-12-7-2)18(14-8-3)22(19,20-9-4)21-10-5/h3,11H,1,7,9-10,12-16H2,2,4-5H3/b18-17+ |
| InChIKey | LCGYNNDHFBUPHA-ISLYRVAYSA-N |
| XLogP | 5.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|