C18H36O3Si — CID 11151612
trans-(2S,4R)-2-(4-hydroxybutyl)-4-tri(propan-2-yl)silyloxycyclopentan-1-one (PubChem CID 11151612) has the molecular formula C18H36O3Si and a molecular weight of 328.57 g/mol. Its IUPAC name is trans-(2S,4R)-2-(4-hydroxybutyl)-4-tri(propan-2-yl)silyloxycyclopentan-1-one.
| Compound Name | trans-(2S,4R)-2-(4-hydroxybutyl)-4-tri(propan-2-yl)silyloxycyclopentan-1-one |
|---|---|
| PubChem CID | 11151612 |
| Molecular Formula | C18H36O3Si |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | trans-(2S,4R)-2-(4-hydroxybutyl)-4-tri(propan-2-yl)silyloxycyclopentan-1-one |
| SMILES | CC(C)[Si](O[C@H]1CC(=O)[C@@H](CCCCO)C1)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H36O3Si/c1-13(2)22(14(3)4,15(5)6)21-17-11-16(18(20)12-17)9-7-8-10-19/h13-17,19H,7-12H2,1-6H3/t16-,17+/m0/s1 |
| InChIKey | CFXCQAQYJWMMFT-DLBZAZTESA-N |
| XLogP | 4.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|