C23H46O3Si — CID 10971355
3-[tert-butyl(dimethyl)silyl]oxy-1-[(2S,3R)-3-hydroxy-3-methyl-2-propan-2-ylcyclopentyl]octan-1-one (PubChem CID 10971355) has the molecular formula C23H46O3Si and a molecular weight of 398.70 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-1-[(2S,3R)-3-hydroxy-3-methyl-2-propan-2-ylcyclopentyl]octan-1-one.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-1-[(2S,3R)-3-hydroxy-3-methyl-2-propan-2-ylcyclopentyl]octan-1-one |
|---|---|
| PubChem CID | 10971355 |
| Molecular Formula | C23H46O3Si |
| Molecular Weight | 398.70 g/mol |
| Exact Mass | 398.32 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-1-[(2S,3R)-3-hydroxy-3-methyl-2-propan-2-ylcyclopentyl]octan-1-one |
| SMILES | CCCCCC(CC(=O)C1CC[C@@](C)(O)[C@H]1C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46O3Si/c1-10-11-12-13-18(26-27(8,9)22(4,5)6)16-20(24)19-14-15-23(7,25)21(19)17(2)3/h17-19,21,25H,10-16H2,1-9H3/t18?,19?,21-,23+/m0/s1 |
| InChIKey | YGQGPJAKRJPSDI-XTRIYOEBSA-N |
| XLogP | 6.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.70 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|