C18H34O4Si — CID 135005691
(2R,3S,4R)-3-acetyl-2-hydroxy-2-methyl-4-[tri(propan-2-yl)silyloxymethyl]cyclopentan-1-one (PubChem CID 135005691) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is (2R,3S,4R)-3-acetyl-2-hydroxy-2-methyl-4-[tri(propan-2-yl)silyloxymethyl]cyclopentan-1-one.
| Compound Name | (2R,3S,4R)-3-acetyl-2-hydroxy-2-methyl-4-[tri(propan-2-yl)silyloxymethyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 135005691 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (2R,3S,4R)-3-acetyl-2-hydroxy-2-methyl-4-[tri(propan-2-yl)silyloxymethyl]cyclopentan-1-one |
| SMILES | CC(=O)[C@H]1[C@H](CO[Si](C(C)C)(C(C)C)C(C)C)CC(=O)[C@]1(C)O |
| InChI | InChI=1S/C18H34O4Si/c1-11(2)23(12(3)4,13(5)6)22-10-15-9-16(20)18(8,21)17(15)14(7)19/h11-13,15,17,21H,9-10H2,1-8H3/t15-,17-,18-/m0/s1 |
| InChIKey | LVIRWEBYTVGIAL-SZMVWBNQSA-N |
| XLogP | 3.72 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|