C24H44O3Si — CID 11475338
(1S,12R,13R,15R)-13-[tert-butyl(dimethyl)silyl]oxy-15-propan-2-ylbicyclo[10.2.1]pentadecane-3,14-dione (PubChem CID 11475338) has the molecular formula C24H44O3Si and a molecular weight of 408.70 g/mol. Its IUPAC name is (1S,12R,13R,15R)-13-[tert-butyl(dimethyl)silyl]oxy-15-propan-2-ylbicyclo[10.2.1]pentadecane-3,14-dione.
| Compound Name | (1S,12R,13R,15R)-13-[tert-butyl(dimethyl)silyl]oxy-15-propan-2-ylbicyclo[10.2.1]pentadecane-3,14-dione |
|---|---|
| PubChem CID | 11475338 |
| Molecular Formula | C24H44O3Si |
| Molecular Weight | 408.70 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | (1S,12R,13R,15R)-13-[tert-butyl(dimethyl)silyl]oxy-15-propan-2-ylbicyclo[10.2.1]pentadecane-3,14-dione |
| SMILES | CC(C)[C@@H]1[C@H]2CCCCCCCCC(=O)C[C@@H]1C(=O)[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H44O3Si/c1-17(2)21-19-15-13-11-9-8-10-12-14-18(25)16-20(21)22(26)23(19)27-28(6,7)24(3,4)5/h17,19-21,23H,8-16H2,1-7H3/t19-,20+,21-,23-/m1/s1 |
| InChIKey | KOZMYOTYWDEPNV-ADYITMSISA-N |
| XLogP | 6.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.70 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|