C26H46F2O5Si — CID 77463141
7-[3-[tert-butyl(dimethyl)silyl]oxy-2-(4,4-difluoro-3-oxooctyl)-5-oxocyclopentyl]heptanoic acid (PubChem CID 77463141) has the molecular formula C26H46F2O5Si and a molecular weight of 504.73 g/mol. Its IUPAC name is 7-[3-[tert-butyl(dimethyl)silyl]oxy-2-(4,4-difluoro-3-oxooctyl)-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[3-[tert-butyl(dimethyl)silyl]oxy-2-(4,4-difluoro-3-oxooctyl)-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 77463141 |
| Molecular Formula | C26H46F2O5Si |
| Molecular Weight | 504.73 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | 7-[3-[tert-butyl(dimethyl)silyl]oxy-2-(4,4-difluoro-3-oxooctyl)-5-oxocyclopentyl]heptanoic acid |
| SMILES | CCCCC(F)(F)C(=O)CCC1C(O[Si](C)(C)C(C)(C)C)CC(=O)C1CCCCCCC(=O)O |
| InChI | InChI=1S/C26H46F2O5Si/c1-7-8-17-26(27,28)23(30)16-15-20-19(13-11-9-10-12-14-24(31)32)21(29)18-22(20)33-34(5,6)25(2,3)4/h19-20,22H,7-18H2,1-6H3,(H,31,32) |
| InChIKey | JZDGNZPVNPADQE-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.73 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|