C15H15F2NO3S — CID 111519591
3-(difluoromethoxy)-N-(2-hydroxy-2-phenylpropyl)thiophene-2-carboxamide (PubChem CID 111519591) has the molecular formula C15H15F2NO3S and a molecular weight of 327.35 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-(2-hydroxy-2-phenylpropyl)thiophene-2-carboxamide.
| Compound Name | 3-(difluoromethoxy)-N-(2-hydroxy-2-phenylpropyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 111519591 |
| Molecular Formula | C15H15F2NO3S |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 3-(difluoromethoxy)-N-(2-hydroxy-2-phenylpropyl)thiophene-2-carboxamide |
| SMILES | CC(O)(CNC(=O)c1sccc1OC(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H15F2NO3S/c1-15(20,10-5-3-2-4-6-10)9-18-13(19)12-11(7-8-22-12)21-14(16)17/h2-8,14,20H,9H2,1H3,(H,18,19) |
| InChIKey | RWMLUFCRMSZYJX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |