C14H12F3NO3S — CID 95901689
3-(difluoromethoxy)-N-[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]thiophene-2-carboxamide (PubChem CID 95901689) has the molecular formula C14H12F3NO3S and a molecular weight of 331.32 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]thiophene-2-carboxamide.
| Compound Name | 3-(difluoromethoxy)-N-[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 95901689 |
| Molecular Formula | C14H12F3NO3S |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 3-(difluoromethoxy)-N-[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]thiophene-2-carboxamide |
| SMILES | O=C(NC[C@H](O)c1cccc(F)c1)c1sccc1OC(F)F |
| InChI | InChI=1S/C14H12F3NO3S/c15-9-3-1-2-8(6-9)10(19)7-18-13(20)12-11(4-5-22-12)21-14(16)17/h1-6,10,14,19H,7H2,(H,18,20)/t10-/m0/s1 |
| InChIKey | TXLZCHTXROTUAH-JTQLQIEISA-N |
| XLogP | 2.95 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |