C22H23FN2OS — CID 55450440
N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-3-(4-methylphenyl)thiophene-2-carboxamide (PubChem CID 55450440) has the molecular formula C22H23FN2OS and a molecular weight of 382.50 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-3-(4-methylphenyl)thiophene-2-carboxamide.
| Compound Name | N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-3-(4-methylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55450440 |
| Molecular Formula | C22H23FN2OS |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-3-(4-methylphenyl)thiophene-2-carboxamide |
| SMILES | Cc1ccc(-c2ccsc2C(=O)NCC(c2cccc(F)c2)N(C)C)cc1 |
| InChI | InChI=1S/C22H23FN2OS/c1-15-7-9-16(10-8-15)19-11-12-27-21(19)22(26)24-14-20(25(2)3)17-5-4-6-18(23)13-17/h4-13,20H,14H2,1-3H3,(H,24,26) |
| InChIKey | ATJNQSYBLUCRJA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |