C17H18FNO4 — CID 56782034
N-[2-(3-fluorophenyl)-2-hydroxyethyl]-2-hydroxy-3-methoxy-5-methylbenzamide (PubChem CID 56782034) has the molecular formula C17H18FNO4 and a molecular weight of 319.33 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)-2-hydroxyethyl]-2-hydroxy-3-methoxy-5-methylbenzamide.
| Compound Name | N-[2-(3-fluorophenyl)-2-hydroxyethyl]-2-hydroxy-3-methoxy-5-methylbenzamide |
|---|---|
| PubChem CID | 56782034 |
| Molecular Formula | C17H18FNO4 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-[2-(3-fluorophenyl)-2-hydroxyethyl]-2-hydroxy-3-methoxy-5-methylbenzamide |
| SMILES | COc1cc(C)cc(C(=O)NCC(O)c2cccc(F)c2)c1O |
| InChI | InChI=1S/C17H18FNO4/c1-10-6-13(16(21)15(7-10)23-2)17(22)19-9-14(20)11-4-3-5-12(18)8-11/h3-8,14,20-21H,9H2,1-2H3,(H,19,22) |
| InChIKey | IJKZTHYIYLWBPW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |