C18H23NO3S — CID 111519603
N-(2-hydroxy-2-thiophen-2-ylpropyl)-2-methyl-4-phenoxybutanamide (PubChem CID 111519603) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-2-ylpropyl)-2-methyl-4-phenoxybutanamide.
| Compound Name | N-(2-hydroxy-2-thiophen-2-ylpropyl)-2-methyl-4-phenoxybutanamide |
|---|---|
| PubChem CID | 111519603 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-2-ylpropyl)-2-methyl-4-phenoxybutanamide |
| SMILES | CC(CCOc1ccccc1)C(=O)NCC(C)(O)c1cccs1 |
| InChI | InChI=1S/C18H23NO3S/c1-14(10-11-22-15-7-4-3-5-8-15)17(20)19-13-18(2,21)16-9-6-12-23-16/h3-9,12,14,21H,10-11,13H2,1-2H3,(H,19,20) |
| InChIKey | XBZNOYMDYSWKER-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |