C18H22FNO2S — CID 111478211
4-(2-fluorophenyl)-N-(2-hydroxy-2-thiophen-2-ylpropyl)-2-methylbutanamide (PubChem CID 111478211) has the molecular formula C18H22FNO2S and a molecular weight of 335.44 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-N-(2-hydroxy-2-thiophen-2-ylpropyl)-2-methylbutanamide.
| Compound Name | 4-(2-fluorophenyl)-N-(2-hydroxy-2-thiophen-2-ylpropyl)-2-methylbutanamide |
|---|---|
| PubChem CID | 111478211 |
| Molecular Formula | C18H22FNO2S |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 4-(2-fluorophenyl)-N-(2-hydroxy-2-thiophen-2-ylpropyl)-2-methylbutanamide |
| SMILES | CC(CCc1ccccc1F)C(=O)NCC(C)(O)c1cccs1 |
| InChI | InChI=1S/C18H22FNO2S/c1-13(9-10-14-6-3-4-7-15(14)19)17(21)20-12-18(2,22)16-8-5-11-23-16/h3-8,11,13,22H,9-10,12H2,1-2H3,(H,20,21) |
| InChIKey | YLLDWGVOYPNYSS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |