C18H21NO3S — CID 111519791
N-(2-hydroxy-2-thiophen-3-ylpropyl)-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide (PubChem CID 111519791) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-3-ylpropyl)-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide.
| Compound Name | N-(2-hydroxy-2-thiophen-3-ylpropyl)-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 111519791 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-3-ylpropyl)-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide |
| SMILES | CC1CC1c1ccc(C=CC(=O)NCC(C)(O)c2ccsc2)o1 |
| InChI | InChI=1S/C18H21NO3S/c1-12-9-15(12)16-5-3-14(22-16)4-6-17(20)19-11-18(2,21)13-7-8-23-10-13/h3-8,10,12,15,21H,9,11H2,1-2H3,(H,19,20) |
| InChIKey | WWPRQHCQLJGBPD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|