About CID 11152344
CID 11152344 (PubChem CID 11152344) has the molecular formula C14H12FeN6O2+2
and a molecular weight of 352.14 g/mol.
Molecular Properties
| Compound Name | CID 11152344 |
| PubChem CID | 11152344 |
| Molecular Formula | C14H12FeN6O2+2 |
| Molecular Weight | 352.14 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | — |
| SMILES | [Fe+2].[N-]=[N+]=NCC(=O)[C]1[CH][CH][CH][CH]1.[N-]=[N+]=NCC(=O)[C]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/2C7H6N3O.Fe/c2*8-10-9-5-7(11)6-3-1-2-4-6;/h2*1-4H,5H2;/q;;+2 |
| InChIKey | FHVXKROFEIMYGN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 131.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.14 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze CID 11152344 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11152344?
The IUPAC name of CID 11152344 (CID 11152344) is not available.
What is the SMILES notation for CID 11152344?
The canonical SMILES for CID 11152344 is [Fe+2].[N-]=[N+]=NCC(=O)[C]1[CH][CH][CH][CH]1.[N-]=[N+]=NCC(=O)[C]1[CH][CH][CH][CH]1.
What is the InChIKey of CID 11152344?
The InChIKey is FHVXKROFEIMYGN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H6N3O.Fe/c2*8-10-9-5-7(11)6-3-1-2-4-6;/h2*1-4H,5H2;/q;;+2.
What are the key properties of CID 11152344?
CID 11152344 has a molecular weight of 352.14 g/mol, XLogP of 2.54, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11152344 is sourced from PubChem (CID 11152344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).