About 2-azido-1-(3,5-dibromophenyl)ethanone
2-azido-1-(3,5-dibromophenyl)ethanone (PubChem CID 139225278) has the molecular formula C8H5Br2N3O
and a molecular weight of 318.96 g/mol. Its IUPAC name is 2-azido-1-(3,5-dibromophenyl)ethanone.
Molecular Properties
| Compound Name | 2-azido-1-(3,5-dibromophenyl)ethanone |
| PubChem CID | 139225278 |
| Molecular Formula | C8H5Br2N3O |
| Molecular Weight | 318.96 g/mol |
| Exact Mass | 316.88 |
| IUPAC Name | 2-azido-1-(3,5-dibromophenyl)ethanone |
| SMILES | [N-]=[N+]=NCC(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C8H5Br2N3O/c9-6-1-5(2-7(10)3-6)8(14)4-12-13-11/h1-3H,4H2 |
| InChIKey | VJYRRKWGWRITCY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.96 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-azido-1-(3,5-dibromophenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azido-1-(3,5-dibromophenyl)ethanone?
The IUPAC name of 2-azido-1-(3,5-dibromophenyl)ethanone (CID 139225278) is 2-azido-1-(3,5-dibromophenyl)ethanone.
What is the SMILES notation for 2-azido-1-(3,5-dibromophenyl)ethanone?
The canonical SMILES for 2-azido-1-(3,5-dibromophenyl)ethanone is [N-]=[N+]=NCC(=O)c1cc(Br)cc(Br)c1.
What is the InChIKey of 2-azido-1-(3,5-dibromophenyl)ethanone?
The InChIKey is VJYRRKWGWRITCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Br2N3O/c9-6-1-5(2-7(10)3-6)8(14)4-12-13-11/h1-3H,4H2.
What are the key properties of 2-azido-1-(3,5-dibromophenyl)ethanone?
2-azido-1-(3,5-dibromophenyl)ethanone has a molecular weight of 318.96 g/mol, XLogP of 3.70, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azido-1-(3,5-dibromophenyl)ethanone is sourced from PubChem (CID 139225278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).