C16H22ClN3O — CID 139798911
2-azido-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethanone;hydrochloride (PubChem CID 139798911) has the molecular formula C16H22ClN3O and a molecular weight of 307.83 g/mol. Its IUPAC name is 2-azido-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethanone;hydrochloride.
| Compound Name | 2-azido-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 139798911 |
| Molecular Formula | C16H22ClN3O |
| Molecular Weight | 307.83 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-azido-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethanone;hydrochloride |
| SMILES | CC1(C)CCC(C)(C)c2cc(C(=O)CN=[N+]=[N-])ccc21.Cl |
| InChI | InChI=1S/C16H21N3O.ClH/c1-15(2)7-8-16(3,4)13-9-11(5-6-12(13)15)14(20)10-18-19-17;/h5-6,9H,7-8,10H2,1-4H3;1H |
| InChIKey | WFPCWIOIHIJNAF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.83 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|