About 4-(2-azidoacetyl)benzoic acid
4-(2-azidoacetyl)benzoic acid (PubChem CID 143075130) has the molecular formula C9H7N3O3
and a molecular weight of 205.17 g/mol. Its IUPAC name is 4-(2-azidoacetyl)benzoic acid.
Molecular Properties
| Compound Name | 4-(2-azidoacetyl)benzoic acid |
| PubChem CID | 143075130 |
| Molecular Formula | C9H7N3O3 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 4-(2-azidoacetyl)benzoic acid |
| SMILES | [N-]=[N+]=NCC(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C9H7N3O3/c10-12-11-5-8(13)6-1-3-7(4-2-6)9(14)15/h1-4H,5H2,(H,14,15) |
| InChIKey | DYCFITGCJLEGOO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 103.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-azidoacetyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-azidoacetyl)benzoic acid?
The IUPAC name of 4-(2-azidoacetyl)benzoic acid (CID 143075130) is 4-(2-azidoacetyl)benzoic acid.
What is the SMILES notation for 4-(2-azidoacetyl)benzoic acid?
The canonical SMILES for 4-(2-azidoacetyl)benzoic acid is [N-]=[N+]=NCC(=O)c1ccc(C(=O)O)cc1.
What is the InChIKey of 4-(2-azidoacetyl)benzoic acid?
The InChIKey is DYCFITGCJLEGOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O3/c10-12-11-5-8(13)6-1-3-7(4-2-6)9(14)15/h1-4H,5H2,(H,14,15).
What are the key properties of 4-(2-azidoacetyl)benzoic acid?
4-(2-azidoacetyl)benzoic acid has a molecular weight of 205.17 g/mol, XLogP of 1.88, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-azidoacetyl)benzoic acid is sourced from PubChem (CID 143075130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).