C21H40O2Si — CID 11152385
(3R,4R,5S,6R)-4-butyl-5-[tert-butyl(dimethyl)silyl]-6-propan-2-yl-3-prop-2-enyloxan-2-one (PubChem CID 11152385) has the molecular formula C21H40O2Si and a molecular weight of 352.64 g/mol. Its IUPAC name is (3R,4R,5S,6R)-4-butyl-5-[tert-butyl(dimethyl)silyl]-6-propan-2-yl-3-prop-2-enyloxan-2-one.
| Compound Name | (3R,4R,5S,6R)-4-butyl-5-[tert-butyl(dimethyl)silyl]-6-propan-2-yl-3-prop-2-enyloxan-2-one |
|---|---|
| PubChem CID | 11152385 |
| Molecular Formula | C21H40O2Si |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | (3R,4R,5S,6R)-4-butyl-5-[tert-butyl(dimethyl)silyl]-6-propan-2-yl-3-prop-2-enyloxan-2-one |
| SMILES | C=CC[C@H]1C(=O)O[C@H](C(C)C)[C@@H]([Si](C)(C)C(C)(C)C)[C@@H]1CCCC |
| InChI | InChI=1S/C21H40O2Si/c1-10-12-14-16-17(13-11-2)20(22)23-18(15(3)4)19(16)24(8,9)21(5,6)7/h11,15-19H,2,10,12-14H2,1,3-9H3/t16-,17-,18-,19+/m1/s1 |
| InChIKey | FWSRFMZLTBLWCS-MKXGPGLRSA-N |
| XLogP | 6.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|