C18H26N6S — CID 111530349
2-methyl-1-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]-3-(3-methylsulfanylcyclopentyl)guanidine (PubChem CID 111530349) has the molecular formula C18H26N6S and a molecular weight of 358.52 g/mol. Its IUPAC name is 2-methyl-1-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]-3-(3-methylsulfanylcyclopentyl)guanidine.
| Compound Name | 2-methyl-1-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]-3-(3-methylsulfanylcyclopentyl)guanidine |
|---|---|
| PubChem CID | 111530349 |
| Molecular Formula | C18H26N6S |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 2-methyl-1-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]-3-(3-methylsulfanylcyclopentyl)guanidine |
| SMILES | C/N=C(\NCc1ccc(-n2ccnc2C)nc1)NC1CCC(SC)C1 |
| InChI | InChI=1S/C18H26N6S/c1-13-20-8-9-24(13)17-7-4-14(11-21-17)12-22-18(19-2)23-15-5-6-16(10-15)25-3/h4,7-9,11,15-16H,5-6,10,12H2,1-3H3,(H2,19,22,23) |
| InChIKey | BTTRRVUBYPEXAB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|