C19H26N6S — CID 111531039
1-[3-(benzimidazol-1-yl)propyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine (PubChem CID 111531039) has the molecular formula C19H26N6S and a molecular weight of 370.53 g/mol. Its IUPAC name is 1-[3-(benzimidazol-1-yl)propyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[3-(benzimidazol-1-yl)propyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111531039 |
| Molecular Formula | C19H26N6S |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 1-[3-(benzimidazol-1-yl)propyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine |
| SMILES | CCc1cnc(CCN/C(=N\C)NCCCn2cnc3ccccc32)s1 |
| InChI | InChI=1S/C19H26N6S/c1-3-15-13-23-18(26-15)9-11-22-19(20-2)21-10-6-12-25-14-24-16-7-4-5-8-17(16)25/h4-5,7-8,13-14H,3,6,9-12H2,1-2H3,(H2,20,21,22) |
| InChIKey | KFZHTBMABPKJJO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|