C26H35NO2 — CID 11153600
(1R,9S,10R)-4-(cyclobutylmethoxy)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-8-one (PubChem CID 11153600) has the molecular formula C26H35NO2 and a molecular weight of 393.57 g/mol. Its IUPAC name is (1R,9S,10R)-4-(cyclobutylmethoxy)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-8-one.
| Compound Name | (1R,9S,10R)-4-(cyclobutylmethoxy)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-8-one |
|---|---|
| PubChem CID | 11153600 |
| Molecular Formula | C26H35NO2 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | (1R,9S,10R)-4-(cyclobutylmethoxy)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-8-one |
| SMILES | O=C1c2ccc(OCC3CCC3)cc2[C@@]23CCCC[C@H]2[C@@H]1N(CC1CCC1)CC3 |
| InChI | InChI=1S/C26H35NO2/c28-25-21-11-10-20(29-17-19-7-4-8-19)15-23(21)26-12-2-1-9-22(26)24(25)27(14-13-26)16-18-5-3-6-18/h10-11,15,18-19,22,24H,1-9,12-14,16-17H2/t22-,24-,26+/m0/s1 |
| InChIKey | CNPKHMRIMIVLGC-LLZJGCNPSA-N |
| XLogP | 5.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |