C19H35N5S — CID 111536183
1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]guanidine (PubChem CID 111536183) has the molecular formula C19H35N5S and a molecular weight of 365.59 g/mol. Its IUPAC name is 1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]guanidine.
| Compound Name | 1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111536183 |
| Molecular Formula | C19H35N5S |
| Molecular Weight | 365.59 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | 1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncc(CC)s1)NCC(C)(C)N1CCCC(C)C1 |
| InChI | InChI=1S/C19H35N5S/c1-6-16-11-21-17(25-16)12-22-18(20-7-2)23-14-19(4,5)24-10-8-9-15(3)13-24/h11,15H,6-10,12-14H2,1-5H3,(H2,20,22,23) |
| InChIKey | GUSGLSKKLAFWDY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|