C19H36IN5S — CID 111532276
1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[2-(3-methylpiperidin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111532276) has the molecular formula C19H36IN5S and a molecular weight of 493.50 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[2-(3-methylpiperidin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[2-(3-methylpiperidin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111532276 |
| Molecular Formula | C19H36IN5S |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[2-(3-methylpiperidin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)N1CCCC(C)C1)NCCc1ncc(CC)s1.I |
| InChI | InChI=1S/C19H35N5S.HI/c1-5-17-13-22-18(25-17)9-10-21-19(20-6-2)23-12-16(4)24-11-7-8-15(3)14-24;/h13,15-16H,5-12,14H2,1-4H3,(H2,20,21,23);1H |
| InChIKey | ORSSPVQGGHZDJR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|