C18H23F2N3O2 — CID 111542426
1-[1-(2,4-difluorophenyl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(2-methoxyethyl)guanidine (PubChem CID 111542426) has the molecular formula C18H23F2N3O2 and a molecular weight of 351.40 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(2-methoxyethyl)guanidine.
| Compound Name | 1-[1-(2,4-difluorophenyl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(2-methoxyethyl)guanidine |
|---|---|
| PubChem CID | 111542426 |
| Molecular Formula | C18H23F2N3O2 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(2-methoxyethyl)guanidine |
| SMILES | COCC/N=C(\NCCc1ccco1)NC(C)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H23F2N3O2/c1-13(16-6-5-14(19)12-17(16)20)23-18(22-9-11-24-2)21-8-7-15-4-3-10-25-15/h3-6,10,12-13H,7-9,11H2,1-2H3,(H2,21,22,23) |
| InChIKey | PXJLUMXROOLQCV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|