C16H19F2N3O — CID 111323662
1-[1-(2,4-difluorophenyl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine (PubChem CID 111323662) has the molecular formula C16H19F2N3O and a molecular weight of 307.34 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[1-(2,4-difluorophenyl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111323662 |
| Molecular Formula | C16H19F2N3O |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCc1ccco1)NC(C)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H19F2N3O/c1-11(14-6-5-12(17)10-15(14)18)21-16(19-2)20-8-7-13-4-3-9-22-13/h3-6,9-11H,7-8H2,1-2H3,(H2,19,20,21) |
| InChIKey | WEPFREQSRXCAGO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|