C24H23N5 — CID 1115490
16-benzylspiro[12,13,14,15,17-pentazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,11,13,16-heptaene-9,1'-cyclohexane] (PubChem CID 1115490) has the molecular formula C24H23N5 and a molecular weight of 381.48 g/mol. Its IUPAC name is 16-benzylspiro[12,13,14,15,17-pentazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,11,13,16-heptaene-9,1'-cyclohexane].
| Compound Name | 16-benzylspiro[12,13,14,15,17-pentazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,11,13,16-heptaene-9,1'-cyclohexane] |
|---|---|
| PubChem CID | 1115490 |
| Molecular Formula | C24H23N5 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 16-benzylspiro[12,13,14,15,17-pentazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,11,13,16-heptaene-9,1'-cyclohexane] |
| SMILES | c1ccc(Cc2nc3c(c4nnnn24)C2(CCCCC2)Cc2ccccc2-3)cc1 |
| InChI | InChI=1S/C24H23N5/c1-3-9-17(10-4-1)15-20-25-22-19-12-6-5-11-18(19)16-24(13-7-2-8-14-24)21(22)23-26-27-28-29(20)23/h1,3-6,9-12H,2,7-8,13-16H2 |
| InChIKey | ZDVKNNNWSKBQMN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |