C20H20N2OS — CID 135464578
2-prop-2-ynylsulfanylspiro[3,6-dihydrobenzo[h]quinazoline-5,1'-cyclohexane]-4-one (PubChem CID 135464578) has the molecular formula C20H20N2OS and a molecular weight of 336.46 g/mol. Its IUPAC name is 2-prop-2-ynylsulfanylspiro[3,6-dihydrobenzo[h]quinazoline-5,1'-cyclohexane]-4-one.
| Compound Name | 2-prop-2-ynylsulfanylspiro[3,6-dihydrobenzo[h]quinazoline-5,1'-cyclohexane]-4-one |
|---|---|
| PubChem CID | 135464578 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-prop-2-ynylsulfanylspiro[3,6-dihydrobenzo[h]quinazoline-5,1'-cyclohexane]-4-one |
| SMILES | C#CCSc1nc2c(c(=O)[nH]1)C1(CCCCC1)Cc1ccccc1-2 |
| InChI | InChI=1S/C20H20N2OS/c1-2-12-24-19-21-17-15-9-5-4-8-14(15)13-20(10-6-3-7-11-20)16(17)18(23)22-19/h1,4-5,8-9H,3,6-7,10-13H2,(H,21,22,23) |
| InChIKey | NKYSCVCHOFSWQV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|