C20H25N5OS — CID 135525908
1-ethyl-3-[(4-oxospiro[3,6-dihydrobenzo[h]quinazoline-5,1'-cyclohexane]-2-yl)amino]thiourea (PubChem CID 135525908) has the molecular formula C20H25N5OS and a molecular weight of 383.52 g/mol. Its IUPAC name is 1-ethyl-3-[(4-oxospiro[3,6-dihydrobenzo[h]quinazoline-5,1'-cyclohexane]-2-yl)amino]thiourea.
| Compound Name | 1-ethyl-3-[(4-oxospiro[3,6-dihydrobenzo[h]quinazoline-5,1'-cyclohexane]-2-yl)amino]thiourea |
|---|---|
| PubChem CID | 135525908 |
| Molecular Formula | C20H25N5OS |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 1-ethyl-3-[(4-oxospiro[3,6-dihydrobenzo[h]quinazoline-5,1'-cyclohexane]-2-yl)amino]thiourea |
| SMILES | CCNC(=S)NNc1nc2c(c(=O)[nH]1)C1(CCCCC1)Cc1ccccc1-2 |
| InChI | InChI=1S/C20H25N5OS/c1-2-21-19(27)25-24-18-22-16-14-9-5-4-8-13(14)12-20(10-6-3-7-11-20)15(16)17(26)23-18/h4-5,8-9H,2-3,6-7,10-12H2,1H3,(H2,21,25,27)(H2,22,23,24,26) |
| InChIKey | XNAFGBWAAKVHCF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|