C18H23N3O2 — CID 135843635
(5R)-5-ethyl-2-(3-hydroxypropylamino)-5-methyl-3,6-dihydrobenzo[h]quinazolin-4-one (PubChem CID 135843635) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is (5R)-5-ethyl-2-(3-hydroxypropylamino)-5-methyl-3,6-dihydrobenzo[h]quinazolin-4-one.
| Compound Name | (5R)-5-ethyl-2-(3-hydroxypropylamino)-5-methyl-3,6-dihydrobenzo[h]quinazolin-4-one |
|---|---|
| PubChem CID | 135843635 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | (5R)-5-ethyl-2-(3-hydroxypropylamino)-5-methyl-3,6-dihydrobenzo[h]quinazolin-4-one |
| SMILES | CC[C@]1(C)Cc2ccccc2-c2nc(NCCCO)[nH]c(=O)c21 |
| InChI | InChI=1S/C18H23N3O2/c1-3-18(2)11-12-7-4-5-8-13(12)15-14(18)16(23)21-17(20-15)19-9-6-10-22/h4-5,7-8,22H,3,6,9-11H2,1-2H3,(H2,19,20,21,23)/t18-/m1/s1 |
| InChIKey | OOZLGRFMKGSZOX-GOSISDBHSA-N |
| XLogP | 2.45 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|