C30H31N5O3S — CID 1410169
1-(furan-2-ylmethyl)-3-[[3-(4-methoxyphenyl)-4-oxospiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-2-yl]amino]thiourea (PubChem CID 1410169) has the molecular formula C30H31N5O3S and a molecular weight of 541.68 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[[3-(4-methoxyphenyl)-4-oxospiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-2-yl]amino]thiourea.
| Compound Name | 1-(furan-2-ylmethyl)-3-[[3-(4-methoxyphenyl)-4-oxospiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-2-yl]amino]thiourea |
|---|---|
| PubChem CID | 1410169 |
| Molecular Formula | C30H31N5O3S |
| Molecular Weight | 541.68 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[[3-(4-methoxyphenyl)-4-oxospiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-2-yl]amino]thiourea |
| SMILES | COc1ccc(-n2c(NNC(=S)NCc3ccco3)nc3c(c2=O)C2(CCCCC2)Cc2ccccc2-3)cc1 |
| InChI | InChI=1S/C30H31N5O3S/c1-37-22-13-11-21(12-14-22)35-27(36)25-26(32-28(35)33-34-29(39)31-19-23-9-7-17-38-23)24-10-4-3-8-20(24)18-30(25)15-5-2-6-16-30/h3-4,7-14,17H,2,5-6,15-16,18-19H2,1H3,(H,32,33)(H2,31,34,39) |
| InChIKey | ZCOLZZSSLWBOFQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.68 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|