C25H34N4O2 — CID 163183714
3-(2,2-dimethyloxan-4-yl)-2-hydrazinylspiro[6H-benzo[h]quinazoline-5,1'-cycloheptane]-4-one (PubChem CID 163183714) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 3-(2,2-dimethyloxan-4-yl)-2-hydrazinylspiro[6H-benzo[h]quinazoline-5,1'-cycloheptane]-4-one.
| Compound Name | 3-(2,2-dimethyloxan-4-yl)-2-hydrazinylspiro[6H-benzo[h]quinazoline-5,1'-cycloheptane]-4-one |
|---|---|
| PubChem CID | 163183714 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 3-(2,2-dimethyloxan-4-yl)-2-hydrazinylspiro[6H-benzo[h]quinazoline-5,1'-cycloheptane]-4-one |
| SMILES | CC1(C)CC(n2c(NN)nc3c(c2=O)C2(CCCCCC2)Cc2ccccc2-3)CCO1 |
| InChI | InChI=1S/C25H34N4O2/c1-24(2)16-18(11-14-31-24)29-22(30)20-21(27-23(29)28-26)19-10-6-5-9-17(19)15-25(20)12-7-3-4-8-13-25/h5-6,9-10,18H,3-4,7-8,11-16,26H2,1-2H3,(H,27,28) |
| InChIKey | ABVQWHZZBGXIHI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|