C26H32N2O2S — CID 2862949
3-(2,2-dimethyloxan-4-yl)-2-prop-2-enylsulfanylspiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one (PubChem CID 2862949) has the molecular formula C26H32N2O2S and a molecular weight of 436.62 g/mol. Its IUPAC name is 3-(2,2-dimethyloxan-4-yl)-2-prop-2-enylsulfanylspiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one.
| Compound Name | 3-(2,2-dimethyloxan-4-yl)-2-prop-2-enylsulfanylspiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one |
|---|---|
| PubChem CID | 2862949 |
| Molecular Formula | C26H32N2O2S |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 3-(2,2-dimethyloxan-4-yl)-2-prop-2-enylsulfanylspiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one |
| SMILES | C=CCSc1nc2c(c(=O)n1C1CCOC(C)(C)C1)C1(CCCC1)Cc1ccccc1-2 |
| InChI | InChI=1S/C26H32N2O2S/c1-4-15-31-24-27-22-20-10-6-5-9-18(20)16-26(12-7-8-13-26)21(22)23(29)28(24)19-11-14-30-25(2,3)17-19/h4-6,9-10,19H,1,7-8,11-17H2,2-3H3 |
| InChIKey | XBFDZKBQUQMFFI-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|