C32H38N4O3 — CID 40597495
N'-[3-[(4R)-2,2-dimethyloxan-4-yl]-4-oxospiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-2-yl]-2-phenylacetohydrazide (PubChem CID 40597495) has the molecular formula C32H38N4O3 and a molecular weight of 526.68 g/mol. Its IUPAC name is N'-[3-[(4R)-2,2-dimethyloxan-4-yl]-4-oxospiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-2-yl]-2-phenylacetohydrazide.
| Compound Name | N'-[3-[(4R)-2,2-dimethyloxan-4-yl]-4-oxospiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-2-yl]-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 40597495 |
| Molecular Formula | C32H38N4O3 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | N'-[3-[(4R)-2,2-dimethyloxan-4-yl]-4-oxospiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-2-yl]-2-phenylacetohydrazide |
| SMILES | CC1(C)C[C@H](n2c(NNC(=O)Cc3ccccc3)nc3c(c2=O)C2(CCCCC2)Cc2ccccc2-3)CCO1 |
| InChI | InChI=1S/C32H38N4O3/c1-31(2)21-24(15-18-39-31)36-29(38)27-28(33-30(36)35-34-26(37)19-22-11-5-3-6-12-22)25-14-8-7-13-23(25)20-32(27)16-9-4-10-17-32/h3,5-8,11-14,24H,4,9-10,15-21H2,1-2H3,(H,33,35)(H,34,37)/t24-/m1/s1 |
| InChIKey | ODNMURSHCXGXGH-XMMPIXPASA-N |
| XLogP | 5.48 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|