C31H30N4O2 — CID 3768284
2-(2-benzylidenehydrazinyl)-3-(2-methoxyphenyl)spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one (PubChem CID 3768284) has the molecular formula C31H30N4O2 and a molecular weight of 490.61 g/mol. Its IUPAC name is 2-(2-benzylidenehydrazinyl)-3-(2-methoxyphenyl)spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one.
| Compound Name | 2-(2-benzylidenehydrazinyl)-3-(2-methoxyphenyl)spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one |
|---|---|
| PubChem CID | 3768284 |
| Molecular Formula | C31H30N4O2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 2-(2-benzylidenehydrazinyl)-3-(2-methoxyphenyl)spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one |
| SMILES | COc1ccccc1-n1c(NN=Cc2ccccc2)nc2c(c1=O)C1(CCCCC1)Cc1ccccc1-2 |
| InChI | InChI=1S/C31H30N4O2/c1-37-26-17-9-8-16-25(26)35-29(36)27-28(33-30(35)34-32-21-22-12-4-2-5-13-22)24-15-7-6-14-23(24)20-31(27)18-10-3-11-19-31/h2,4-9,12-17,21H,3,10-11,18-20H2,1H3,(H,33,34) |
| InChIKey | FYGCUNCVOBIEQG-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|