C31H29BrN4O — CID 4978747
2-[2-[(4-bromophenyl)methylidene]hydrazinyl]-3-(4-methylphenyl)spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one (PubChem CID 4978747) has the molecular formula C31H29BrN4O and a molecular weight of 553.50 g/mol. Its IUPAC name is 2-[2-[(4-bromophenyl)methylidene]hydrazinyl]-3-(4-methylphenyl)spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one.
| Compound Name | 2-[2-[(4-bromophenyl)methylidene]hydrazinyl]-3-(4-methylphenyl)spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one |
|---|---|
| PubChem CID | 4978747 |
| Molecular Formula | C31H29BrN4O |
| Molecular Weight | 553.50 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | 2-[2-[(4-bromophenyl)methylidene]hydrazinyl]-3-(4-methylphenyl)spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one |
| SMILES | Cc1ccc(-n2c(NN=Cc3ccc(Br)cc3)nc3c(c2=O)C2(CCCCC2)Cc2ccccc2-3)cc1 |
| InChI | InChI=1S/C31H29BrN4O/c1-21-9-15-25(16-10-21)36-29(37)27-28(34-30(36)35-33-20-22-11-13-24(32)14-12-22)26-8-4-3-7-23(26)19-31(27)17-5-2-6-18-31/h3-4,7-16,20H,2,5-6,17-19H2,1H3,(H,34,35) |
| InChIKey | FJNFZXASDFLVQM-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.50 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|