C23H21N3O4 — CID 4597615
N-(furan-2-ylmethyl)-1,3-bis(4-methoxyphenyl)pyrazole-5-carboxamide (PubChem CID 4597615) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1,3-bis(4-methoxyphenyl)pyrazole-5-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-1,3-bis(4-methoxyphenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4597615 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N-(furan-2-ylmethyl)-1,3-bis(4-methoxyphenyl)pyrazole-5-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NCc3ccco3)n(-c3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C23H21N3O4/c1-28-18-9-5-16(6-10-18)21-14-22(23(27)24-15-20-4-3-13-30-20)26(25-21)17-7-11-19(29-2)12-8-17/h3-14H,15H2,1-2H3,(H,24,27) |
| InChIKey | QYRZLKHNLOJPQZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |