C14H13N5O3 — CID 71791372
N-(furan-2-ylmethyl)-2-(4-methoxyphenyl)tetrazole-5-carboxamide (PubChem CID 71791372) has the molecular formula C14H13N5O3 and a molecular weight of 299.29 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(4-methoxyphenyl)tetrazole-5-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-2-(4-methoxyphenyl)tetrazole-5-carboxamide |
|---|---|
| PubChem CID | 71791372 |
| Molecular Formula | C14H13N5O3 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(4-methoxyphenyl)tetrazole-5-carboxamide |
| SMILES | COc1ccc(-n2nnc(C(=O)NCc3ccco3)n2)cc1 |
| InChI | InChI=1S/C14H13N5O3/c1-21-11-6-4-10(5-7-11)19-17-13(16-18-19)14(20)15-9-12-3-2-8-22-12/h2-8H,9H2,1H3,(H,15,20) |
| InChIKey | FGZKGMMWZRURQO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |