C24H24N4O2 — CID 135408350
N'-(4-oxospiro[3,6-dihydrobenzo[h]quinazoline-5,1'-cyclohexane]-2-yl)benzohydrazide (PubChem CID 135408350) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is N'-(4-oxospiro[3,6-dihydrobenzo[h]quinazoline-5,1'-cyclohexane]-2-yl)benzohydrazide.
| Compound Name | N'-(4-oxospiro[3,6-dihydrobenzo[h]quinazoline-5,1'-cyclohexane]-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 135408350 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | N'-(4-oxospiro[3,6-dihydrobenzo[h]quinazoline-5,1'-cyclohexane]-2-yl)benzohydrazide |
| SMILES | O=C(NNc1nc2c(c(=O)[nH]1)C1(CCCCC1)Cc1ccccc1-2)c1ccccc1 |
| InChI | InChI=1S/C24H24N4O2/c29-21(16-9-3-1-4-10-16)27-28-23-25-20-18-12-6-5-11-17(18)15-24(13-7-2-8-14-24)19(20)22(30)26-23/h1,3-6,9-12H,2,7-8,13-15H2,(H,27,29)(H2,25,26,28,30) |
| InChIKey | HONCPXBUKQNSSN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|