C17H20IN5 — CID 111549378
2-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-1-phenylguanidine;hydroiodide (PubChem CID 111549378) has the molecular formula C17H20IN5 and a molecular weight of 421.29 g/mol. Its IUPAC name is 2-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-1-phenylguanidine;hydroiodide.
| Compound Name | 2-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-1-phenylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111549378 |
| Molecular Formula | C17H20IN5 |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 2-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-1-phenylguanidine;hydroiodide |
| SMILES | Cc1cccn2cc(CC/N=C(\N)Nc3ccccc3)nc12.I |
| InChI | InChI=1S/C17H19N5.HI/c1-13-6-5-11-22-12-15(20-16(13)22)9-10-19-17(18)21-14-7-3-2-4-8-14;/h2-8,11-12H,9-10H2,1H3,(H3,18,19,21);1H |
| InChIKey | CGSWQFHVWIIEKW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|